C24H21FN4O2 — CID 108854800
(Z)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile (PubChem CID 108854800) has the molecular formula C24H21FN4O2 and a molecular weight of 416.46 g/mol. Its IUPAC name is (Z)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108854800 |
| Molecular Formula | C24H21FN4O2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (Z)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cccc2c(O)cccc12)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H21FN4O2/c25-18-7-9-19(10-8-18)28-11-13-29(14-12-28)24(31)17(15-26)16-27-22-5-1-4-21-20(22)3-2-6-23(21)30/h1-10,16,27,30H,11-14H2/b17-16- |
| InChIKey | JAJFKLRJDOZQKL-MSUUIHNZSA-N |
| XLogP | 3.85 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|