C31H28N4O2 — CID 108832508
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile (PubChem CID 108832508) has the molecular formula C31H28N4O2 and a molecular weight of 488.59 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832508 |
| Molecular Formula | C31H28N4O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cccc2c(O)cccc12)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H28N4O2/c32-21-25(22-33-28-15-7-14-27-26(28)13-8-16-29(27)36)31(37)35-19-17-34(18-20-35)30(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-16,22,30,33,36H,17-20H2/b25-22- |
| InChIKey | HRBOOSUHCCKXED-LVWGJNHUSA-N |
| XLogP | 5.30 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|