C30H32N4O — CID 108832460
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2-propan-2-ylanilino)prop-2-enenitrile (PubChem CID 108832460) has the molecular formula C30H32N4O and a molecular weight of 464.61 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2-propan-2-ylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2-propan-2-ylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108832460 |
| Molecular Formula | C30H32N4O |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2-propan-2-ylanilino)prop-2-enenitrile |
| SMILES | CC(C)c1ccccc1N/C=C(/C#N)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H32N4O/c1-23(2)27-15-9-10-16-28(27)32-22-26(21-31)30(35)34-19-17-33(18-20-34)29(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-16,22-23,29,32H,17-20H2,1-2H3/b26-22- |
| InChIKey | RYXLJUYEGYAOGC-ROMGYVFFSA-N |
| XLogP | 5.56 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|