C33H36N4O — CID 108832524
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]prop-2-enenitrile (PubChem CID 108832524) has the molecular formula C33H36N4O and a molecular weight of 504.68 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832524 |
| Molecular Formula | C33H36N4O |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]prop-2-enenitrile |
| SMILES | CC(N/C=C(/C#N)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C33H36N4O/c1-25(29-17-16-26-10-8-9-15-30(26)22-29)35-24-31(23-34)33(38)37-20-18-36(19-21-37)32(27-11-4-2-5-12-27)28-13-6-3-7-14-28/h2-7,11-14,16-17,22,24-25,32,35H,8-10,15,18-21H2,1H3/b31-24- |
| InChIKey | JAGLAIUCWLVXMM-QLTSDVKISA-N |
| XLogP | 5.56 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|