C28H27BrN4O — CID 108832736
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile (PubChem CID 108832736) has the molecular formula C28H27BrN4O and a molecular weight of 515.46 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108832736 |
| Molecular Formula | C28H27BrN4O |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile |
| SMILES | Cc1cc(N/C=C(/C#N)C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)ccc1Br |
| InChI | InChI=1S/C28H27BrN4O/c1-21-18-25(12-13-26(21)29)31-20-24(19-30)28(34)33-16-14-32(15-17-33)27(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-13,18,20,27,31H,14-17H2,1H3/b24-20- |
| InChIKey | IKDGXRCPEOESDF-GFMRDNFCSA-N |
| XLogP | 5.51 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|