C23H24BrN3O — CID 108838311
(Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile (PubChem CID 108838311) has the molecular formula C23H24BrN3O and a molecular weight of 438.37 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838311 |
| Molecular Formula | C23H24BrN3O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-bromo-3-methylanilino)prop-2-enenitrile |
| SMILES | Cc1cc(N/C=C(/C#N)C(=O)N2CCC(Cc3ccccc3)CC2)ccc1Br |
| InChI | InChI=1S/C23H24BrN3O/c1-17-13-21(7-8-22(17)24)26-16-20(15-25)23(28)27-11-9-19(10-12-27)14-18-5-3-2-4-6-18/h2-8,13,16,19,26H,9-12,14H2,1H3/b20-16- |
| InChIKey | SUFUEZFJMIAQRG-SILNSSARSA-N |
| XLogP | 5.06 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|