C19H20N4OS — CID 108838150
(Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(1,3-thiazol-2-ylamino)prop-2-enenitrile (PubChem CID 108838150) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(1,3-thiazol-2-ylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(1,3-thiazol-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838150 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(1,3-thiazol-2-ylamino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1nccs1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20N4OS/c20-13-17(14-22-19-21-8-11-25-19)18(24)23-9-6-16(7-10-23)12-15-4-2-1-3-5-15/h1-5,8,11,14,16H,6-7,9-10,12H2,(H,21,22)/b17-14- |
| InChIKey | VNUPFZZLIABWJD-VKAVYKQESA-N |
| XLogP | 3.44 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|