C28H27N3O2 — CID 108838098
(Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-phenoxyanilino)prop-2-enenitrile (PubChem CID 108838098) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-phenoxyanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-phenoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838098 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(4-phenoxyanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccc(Oc2ccccc2)cc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27N3O2/c29-20-24(21-30-25-11-13-27(14-12-25)33-26-9-5-2-6-10-26)28(32)31-17-15-23(16-18-31)19-22-7-3-1-4-8-22/h1-14,21,23,30H,15-19H2/b24-21- |
| InChIKey | POHASYJHSWKNDL-FLFQWRMESA-N |
| XLogP | 5.78 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|