C22H21F2N3O — CID 108838324
(Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,5-difluoroanilino)prop-2-enenitrile (PubChem CID 108838324) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,5-difluoroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,5-difluoroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838324 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,5-difluoroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cc(F)ccc1F)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H21F2N3O/c23-19-6-7-20(24)21(13-19)26-15-18(14-25)22(28)27-10-8-17(9-11-27)12-16-4-2-1-3-5-16/h1-7,13,15,17,26H,8-12H2/b18-15- |
| InChIKey | DJKZMKULDINPEA-SDXDJHTJSA-N |
| XLogP | 4.27 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|