C29H29N3O — CID 108838225
(Z)-3-(N-benzylanilino)-2-(4-benzylpiperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 108838225) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is (Z)-3-(N-benzylanilino)-2-(4-benzylpiperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(N-benzylanilino)-2-(4-benzylpiperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838225 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (Z)-3-(N-benzylanilino)-2-(4-benzylpiperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/N(Cc1ccccc1)c1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N3O/c30-21-27(23-32(28-14-8-3-9-15-28)22-26-12-6-2-7-13-26)29(33)31-18-16-25(17-19-31)20-24-10-4-1-5-11-24/h1-15,23,25H,16-20,22H2/b27-23- |
| InChIKey | VINCPDIXYXXWJH-VYIQYICTSA-N |
| XLogP | 5.58 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|