C23H23N3O3 — CID 108832281
1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 108832281) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108832281 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | N#C/C(=C/N(Cc1ccccc1)c1ccccc1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C23H23N3O3/c24-15-20(22(27)25-13-11-19(12-14-25)23(28)29)17-26(21-9-5-2-6-10-21)16-18-7-3-1-4-8-18/h1-10,17,19H,11-14,16H2,(H,28,29)/b20-17- |
| InChIKey | NJWRHUPOZJIOKQ-JZJYNLBNSA-N |
| XLogP | 3.42 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|