C27H27N3O — CID 108830051
(Z)-N-benzyl-3-(N-benzylanilino)-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 108830051) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is (Z)-N-benzyl-3-(N-benzylanilino)-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | (Z)-N-benzyl-3-(N-benzylanilino)-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 108830051 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (Z)-N-benzyl-3-(N-benzylanilino)-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)/C(C#N)=C\N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O/c1-22(2)30(20-24-14-8-4-9-15-24)27(31)25(18-28)21-29(26-16-10-5-11-17-26)19-23-12-6-3-7-13-23/h3-17,21-22H,19-20H2,1-2H3/b25-21- |
| InChIKey | WBBIHZGQNYMVME-DAFNUICNSA-N |
| XLogP | 5.54 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|