C20H20ClN3O — CID 108854199
(Z)-3-(N-benzylanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide (PubChem CID 108854199) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is (Z)-3-(N-benzylanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(N-benzylanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854199 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (Z)-3-(N-benzylanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/N(Cc1ccccc1)c1ccccc1)C(=O)NCCCCl |
| InChI | InChI=1S/C20H20ClN3O/c21-12-7-13-23-20(25)18(14-22)16-24(19-10-5-2-6-11-19)15-17-8-3-1-4-9-17/h1-6,8-11,16H,7,12-13,15H2,(H,23,25)/b18-16- |
| InChIKey | VGYOGVQKGNOPRJ-VLGSPTGOSA-N |
| XLogP | 3.85 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|