C29H23N3OS — CID 108857183
(Z)-3-(N-benzylanilino)-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857183) has the molecular formula C29H23N3OS and a molecular weight of 461.59 g/mol. Its IUPAC name is (Z)-3-(N-benzylanilino)-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(N-benzylanilino)-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857183 |
| Molecular Formula | C29H23N3OS |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (Z)-3-(N-benzylanilino)-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N(Cc1ccccc1)c1ccccc1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C29H23N3OS/c30-20-24(22-32(25-14-6-2-7-15-25)21-23-12-4-1-5-13-23)29(33)31-27-18-10-11-19-28(27)34-26-16-8-3-9-17-26/h1-19,22H,21H2,(H,31,33)/b24-22- |
| InChIKey | WNSWVEKWWRNHMN-GYHWCHFESA-N |
| XLogP | 6.89 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|