C22H25N3O3S — CID 108857324
(Z)-2-cyano-3-(2,2-diethoxyethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857324) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,2-diethoxyethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,2-diethoxyethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857324 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (Z)-2-cyano-3-(2,2-diethoxyethylamino)-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | CCOC(CN/C=C(/C#N)C(=O)Nc1ccccc1Sc1ccccc1)OCC |
| InChI | InChI=1S/C22H25N3O3S/c1-3-27-21(28-4-2)16-24-15-17(14-23)22(26)25-19-12-8-9-13-20(19)29-18-10-6-5-7-11-18/h5-13,15,21,24H,3-4,16H2,1-2H3,(H,25,26)/b17-15- |
| InChIKey | HZNNXJZIHLRPGM-ICFOKQHNSA-N |
| XLogP | 4.17 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|