C24H29N3O2 — CID 108837106
(Z)-3-(N-benzylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide (PubChem CID 108837106) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (Z)-3-(N-benzylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(N-benzylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108837106 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (Z)-3-(N-benzylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-3-16-29-17-10-15-26-24(28)22(18-25)20-27(23-13-8-5-9-14-23)19-21-11-6-4-7-12-21/h4-9,11-14,20H,2-3,10,15-17,19H2,1H3,(H,26,28)/b22-20- |
| InChIKey | LSPUPOKNTOIQNK-XDOYNYLZSA-N |
| XLogP | 4.42 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|