C17H23N3O — CID 108833842
(Z)-N-butyl-2-cyano-3-(N-ethyl-3-methylanilino)prop-2-enamide (PubChem CID 108833842) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (Z)-N-butyl-2-cyano-3-(N-ethyl-3-methylanilino)prop-2-enamide.
| Compound Name | (Z)-N-butyl-2-cyano-3-(N-ethyl-3-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108833842 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (Z)-N-butyl-2-cyano-3-(N-ethyl-3-methylanilino)prop-2-enamide |
| SMILES | CCCCNC(=O)/C(C#N)=C\N(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C17H23N3O/c1-4-6-10-19-17(21)15(12-18)13-20(5-2)16-9-7-8-14(3)11-16/h7-9,11,13H,4-6,10H2,1-3H3,(H,19,21)/b15-13- |
| InChIKey | ONNHRICRLPWNIJ-SQFISAMPSA-N |
| XLogP | 3.15 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|