C20H28N2O — CID 2364647
(E)-2-cyano-3-(2,4-dimethylphenyl)-N-octylprop-2-enamide (PubChem CID 2364647) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,4-dimethylphenyl)-N-octylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,4-dimethylphenyl)-N-octylprop-2-enamide |
|---|---|
| PubChem CID | 2364647 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (E)-2-cyano-3-(2,4-dimethylphenyl)-N-octylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C20H28N2O/c1-4-5-6-7-8-9-12-22-20(23)19(15-21)14-18-11-10-16(2)13-17(18)3/h10-11,13-14H,4-9,12H2,1-3H3,(H,22,23)/b19-14+ |
| InChIKey | POQKRGFBTMNSRI-XMHGGMMESA-N |
| XLogP | 4.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|