C18H22F2N2O — CID 2370490
(E)-2-cyano-3-(2,6-difluorophenyl)-N-octylprop-2-enamide (PubChem CID 2370490) has the molecular formula C18H22F2N2O and a molecular weight of 320.38 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,6-difluorophenyl)-N-octylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,6-difluorophenyl)-N-octylprop-2-enamide |
|---|---|
| PubChem CID | 2370490 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (E)-2-cyano-3-(2,6-difluorophenyl)-N-octylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1c(F)cccc1F |
| InChI | InChI=1S/C18H22F2N2O/c1-2-3-4-5-6-7-11-22-18(23)14(13-21)12-15-16(19)9-8-10-17(15)20/h8-10,12H,2-7,11H2,1H3,(H,22,23)/b14-12+ |
| InChIKey | NEEUZQMKGGWUGG-WYMLVPIESA-N |
| XLogP | 4.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|