C18H23BrN2O — CID 2360376
(E)-3-(2-bromophenyl)-2-cyano-N-octylprop-2-enamide (PubChem CID 2360376) has the molecular formula C18H23BrN2O and a molecular weight of 363.30 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-2-cyano-N-octylprop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-2-cyano-N-octylprop-2-enamide |
|---|---|
| PubChem CID | 2360376 |
| Molecular Formula | C18H23BrN2O |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (E)-3-(2-bromophenyl)-2-cyano-N-octylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1ccccc1Br |
| InChI | InChI=1S/C18H23BrN2O/c1-2-3-4-5-6-9-12-21-18(22)16(14-20)13-15-10-7-8-11-17(15)19/h7-8,10-11,13H,2-6,9,12H2,1H3,(H,21,22)/b16-13+ |
| InChIKey | QUHZJSYIECNMRV-DTQAZKPQSA-N |
| XLogP | 4.83 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|