C26H29N3O3S — CID 71546808
(E)-3-[1-(benzenesulfonyl)indol-3-yl]-2-cyano-N-octylprop-2-enamide (PubChem CID 71546808) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is (E)-3-[1-(benzenesulfonyl)indol-3-yl]-2-cyano-N-octylprop-2-enamide.
| Compound Name | (E)-3-[1-(benzenesulfonyl)indol-3-yl]-2-cyano-N-octylprop-2-enamide |
|---|---|
| PubChem CID | 71546808 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (E)-3-[1-(benzenesulfonyl)indol-3-yl]-2-cyano-N-octylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H29N3O3S/c1-2-3-4-5-6-12-17-28-26(30)21(19-27)18-22-20-29(25-16-11-10-15-24(22)25)33(31,32)23-13-8-7-9-14-23/h7-11,13-16,18,20H,2-6,12,17H2,1H3,(H,28,30)/b21-18+ |
| InChIKey | PTIBDXMQERZBCH-DYTRJAOYSA-N |
| XLogP | 5.26 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|