C19H15N3O3S — CID 2372285
(Z)-2-cyano-3-[1-(4-methylphenyl)sulfonylindol-3-yl]prop-2-enamide (PubChem CID 2372285) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(4-methylphenyl)sulfonylindol-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(4-methylphenyl)sulfonylindol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2372285 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (Z)-2-cyano-3-[1-(4-methylphenyl)sulfonylindol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(/C=C(/C#N)C(N)=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H15N3O3S/c1-13-6-8-16(9-7-13)26(24,25)22-12-15(10-14(11-20)19(21)23)17-4-2-3-5-18(17)22/h2-10,12H,1H3,(H2,21,23)/b14-10- |
| InChIKey | LPGGXLDYODLKQP-UVTDQMKNSA-N |
| XLogP | 2.58 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|