C25H20N2O3S — CID 162417672
(2S)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-oxo-4-phenylbutanenitrile (PubChem CID 162417672) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is (2S)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-oxo-4-phenylbutanenitrile.
| Compound Name | (2S)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-oxo-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 162417672 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2S)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-oxo-4-phenylbutanenitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@@H](C#N)CC(=O)c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H20N2O3S/c1-18-11-13-21(14-12-18)31(29,30)27-17-23(22-9-5-6-10-24(22)27)20(16-26)15-25(28)19-7-3-2-4-8-19/h2-14,17,20H,15H2,1H3/t20-/m1/s1 |
| InChIKey | QKCFAQMJDGTLAQ-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 79.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |