C24H21N3O3S — CID 146000657
N-[(E)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethylideneamino]benzamide (PubChem CID 146000657) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[(E)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethylideneamino]benzamide.
| Compound Name | N-[(E)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 146000657 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[(E)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H21N3O3S/c1-17-12-14-20(15-13-17)31(29,30)27-16-22(21-10-6-7-11-23(21)27)18(2)25-26-24(28)19-8-4-3-5-9-19/h3-16H,1-2H3,(H,26,28)/b25-18+ |
| InChIKey | ZISBCIFSUZYMHM-XIEYBQDHSA-N |
| XLogP | 4.34 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|