C24H20N4O5S — CID 154926578
2-methyl-N-[(E)-1-[1-(3-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]benzamide (PubChem CID 154926578) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-methyl-N-[(E)-1-[1-(3-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]benzamide.
| Compound Name | 2-methyl-N-[(E)-1-[1-(3-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 154926578 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-methyl-N-[(E)-1-[1-(3-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1C)c1cn(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c2ccccc12 |
| InChI | InChI=1S/C24H20N4O5S/c1-16-8-3-4-11-20(16)24(29)26-25-17(2)22-15-27(23-13-6-5-12-21(22)23)34(32,33)19-10-7-9-18(14-19)28(30)31/h3-15H,1-2H3,(H,26,29)/b25-17+ |
| InChIKey | FTONDVQFGIYJLA-KOEQRZSOSA-N |
| XLogP | 4.25 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|