C25H24N4O7S2 — CID 162648076
N-[2-[benzenesulfonyl(methyl)amino]ethyl]-N-methyl-1-(3-nitrophenyl)sulfonylindole-3-carboxamide (PubChem CID 162648076) has the molecular formula C25H24N4O7S2 and a molecular weight of 556.62 g/mol. Its IUPAC name is N-[2-[benzenesulfonyl(methyl)amino]ethyl]-N-methyl-1-(3-nitrophenyl)sulfonylindole-3-carboxamide.
| Compound Name | N-[2-[benzenesulfonyl(methyl)amino]ethyl]-N-methyl-1-(3-nitrophenyl)sulfonylindole-3-carboxamide |
|---|---|
| PubChem CID | 162648076 |
| Molecular Formula | C25H24N4O7S2 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | N-[2-[benzenesulfonyl(methyl)amino]ethyl]-N-methyl-1-(3-nitrophenyl)sulfonylindole-3-carboxamide |
| SMILES | CN(CCN(C)S(=O)(=O)c1ccccc1)C(=O)c1cn(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c2ccccc12 |
| InChI | InChI=1S/C25H24N4O7S2/c1-26(15-16-27(2)37(33,34)20-10-4-3-5-11-20)25(30)23-18-28(24-14-7-6-13-22(23)24)38(35,36)21-12-8-9-19(17-21)29(31)32/h3-14,17-18H,15-16H2,1-2H3 |
| InChIKey | IJMGGXBNMRBBCS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 139.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|