C17H16N6O4S — CID 85088396
2-[1-[1-(2-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]guanidine (PubChem CID 85088396) has the molecular formula C17H16N6O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-[1-[1-(2-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]guanidine.
| Compound Name | 2-[1-[1-(2-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 85088396 |
| Molecular Formula | C17H16N6O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[1-[1-(2-nitrophenyl)sulfonylindol-3-yl]ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)c1cn(S(=O)(=O)c2ccccc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C17H16N6O4S/c1-11(20-21-17(18)19)13-10-22(14-7-3-2-6-12(13)14)28(26,27)16-9-5-4-8-15(16)23(24)25/h2-10H,1H3,(H4,18,19,21) |
| InChIKey | VVVAUXZGEHHSJS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|