C18H16N6O2S — CID 85134514
2-[1-[1-(benzenesulfonyl)-5-cyanoindol-3-yl]ethylideneamino]guanidine (PubChem CID 85134514) has the molecular formula C18H16N6O2S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[1-[1-(benzenesulfonyl)-5-cyanoindol-3-yl]ethylideneamino]guanidine.
| Compound Name | 2-[1-[1-(benzenesulfonyl)-5-cyanoindol-3-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 85134514 |
| Molecular Formula | C18H16N6O2S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[1-[1-(benzenesulfonyl)-5-cyanoindol-3-yl]ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)c1cn(S(=O)(=O)c2ccccc2)c2ccc(C#N)cc12 |
| InChI | InChI=1S/C18H16N6O2S/c1-12(22-23-18(20)21)16-11-24(17-8-7-13(10-19)9-15(16)17)27(25,26)14-5-3-2-4-6-14/h2-9,11H,1H3,(H4,20,21,23) |
| InChIKey | SVLNTUAXEASZSH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|