C16H18N6O3S — CID 10474545
2-[(Z)-1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]indol-3-yl]ethylideneamino]guanidine (PubChem CID 10474545) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[(Z)-1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]indol-3-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(Z)-1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]indol-3-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 10474545 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[(Z)-1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]indol-3-yl]ethylideneamino]guanidine |
| SMILES | C/C(=N/N=C(N)N)c1cn(S(=O)(=O)c2c(C)noc2C)c2ccccc12 |
| InChI | InChI=1S/C16H18N6O3S/c1-9(19-20-16(17)18)13-8-22(14-7-5-4-6-12(13)14)26(23,24)15-10(2)21-25-11(15)3/h4-8H,1-3H3,(H4,17,18,20)/b19-9- |
| InChIKey | XZZYDHKPCSEQKH-OCKHKDLRSA-N |
| XLogP | 1.48 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|