C14H12BrClN2O3S — CID 69182914
4-[5-bromo-3-(chloromethyl)indol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole (PubChem CID 69182914) has the molecular formula C14H12BrClN2O3S and a molecular weight of 403.69 g/mol. Its IUPAC name is 4-[5-bromo-3-(chloromethyl)indol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[5-bromo-3-(chloromethyl)indol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 69182914 |
| Molecular Formula | C14H12BrClN2O3S |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 4-[5-bromo-3-(chloromethyl)indol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)n1cc(CCl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H12BrClN2O3S/c1-8-14(9(2)21-17-8)22(19,20)18-7-10(6-16)12-5-11(15)3-4-13(12)18/h3-5,7H,6H2,1-2H3 |
| InChIKey | HPBSFOQYRYAZOB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|