C14H12ClN3O5S — CID 69184352
4-[3-(chloromethyl)-5-nitroindol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole (PubChem CID 69184352) has the molecular formula C14H12ClN3O5S and a molecular weight of 369.79 g/mol. Its IUPAC name is 4-[3-(chloromethyl)-5-nitroindol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[3-(chloromethyl)-5-nitroindol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 69184352 |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 4-[3-(chloromethyl)-5-nitroindol-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)n1cc(CCl)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H12ClN3O5S/c1-8-14(9(2)23-16-8)24(21,22)17-7-10(6-15)12-5-11(18(19)20)3-4-13(12)17/h3-5,7H,6H2,1-2H3 |
| InChIKey | OBEOAHLIFDFFGC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|