C24H20N4O8S — CID 102595912
[5-nitro-1-(4-nitrophenyl)sulfonylindol-3-yl]methyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 102595912) has the molecular formula C24H20N4O8S and a molecular weight of 524.51 g/mol. Its IUPAC name is [5-nitro-1-(4-nitrophenyl)sulfonylindol-3-yl]methyl (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [5-nitro-1-(4-nitrophenyl)sulfonylindol-3-yl]methyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 102595912 |
| Molecular Formula | C24H20N4O8S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | [5-nitro-1-(4-nitrophenyl)sulfonylindol-3-yl]methyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OCc1cn(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C24H20N4O8S/c25-22(12-16-4-2-1-3-5-16)24(29)36-15-17-14-26(23-11-8-19(28(32)33)13-21(17)23)37(34,35)20-9-6-18(7-10-20)27(30)31/h1-11,13-14,22H,12,15,25H2/t22-/m0/s1 |
| InChIKey | UUXIXFLNMAEYSB-QFIPXVFZSA-N |
| XLogP | 3.31 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|