About naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride
naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 141427624) has the molecular formula C20H20ClNO2
and a molecular weight of 341.84 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| PubChem CID | 141427624 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H19NO2.ClH/c21-19(13-15-7-2-1-3-8-15)20(22)23-14-17-11-6-10-16-9-4-5-12-18(16)17;/h1-12,19H,13-14,21H2;1H/t19-;/m0./s1 |
| InChIKey | RROJAFZWZKOIPG-FYZYNONXSA-N |
| XLogP | 3.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The IUPAC name of naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CID 141427624) is naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
What is the SMILES notation for naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The canonical SMILES for naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is Cl.N[C@@H](Cc1ccccc1)C(=O)OCc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The InChIKey is RROJAFZWZKOIPG-FYZYNONXSA-N. The full InChI is InChI=1S/C20H19NO2.ClH/c21-19(13-15-7-2-1-3-8-15)20(22)23-14-17-11-6-10-16-9-4-5-12-18(16)17;/h1-12,19H,13-14,21H2;1H/t19-;/m0./s1.
What are the key properties of naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride has a molecular weight of 341.84 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 141427624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).