About (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate
(3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 57184101) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate |
| PubChem CID | 57184101 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | Nc1cccc(COC(=O)[C@@H](N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2O2/c17-14-8-4-7-13(9-14)11-20-16(19)15(18)10-12-5-2-1-3-6-12/h1-9,15H,10-11,17-18H2/t15-/m0/s1 |
| InChIKey | KUZPYXNMMKFSGU-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate?
The IUPAC name of (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate (CID 57184101) is (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate.
What is the SMILES notation for (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate?
The canonical SMILES for (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate is Nc1cccc(COC(=O)[C@@H](N)Cc2ccccc2)c1.
What is the InChIKey of (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate?
The InChIKey is KUZPYXNMMKFSGU-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H18N2O2/c17-14-8-4-7-13(9-14)11-20-16(19)15(18)10-12-5-2-1-3-6-12/h1-9,15H,10-11,17-18H2/t15-/m0/s1.
What are the key properties of (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate?
(3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate has a molecular weight of 270.33 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)methyl (2S)-2-amino-3-phenylpropanoate is sourced from PubChem (CID 57184101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).