C9H14Cl2N2O2 — CID 168719794
(2R)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride (PubChem CID 168719794) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride.
| Compound Name | (2R)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 168719794 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (2R)-2-amino-3-(3-aminophenyl)propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C9H12N2O2.2ClH/c10-7-3-1-2-6(4-7)5-8(11)9(12)13;;/h1-4,8H,5,10-11H2,(H,12,13);2*1H/t8-;;/m1../s1 |
| InChIKey | KUYMDLJJQHYMCD-YCBDHFTFSA-N |
| XLogP | 1.07 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|