About (2S)-2-amino-3-phenylpropanoic acid;aniline
(2S)-2-amino-3-phenylpropanoic acid;aniline (PubChem CID 159455369) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;aniline.
Molecular Properties
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;aniline |
| PubChem CID | 159455369 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;aniline |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO2.C6H7N/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5,8H,6,10H2,(H,11,12);1-5H,7H2/t8-;/m0./s1 |
| InChIKey | LTXCOLDSOIFHGC-QRPNPIFTSA-N |
| XLogP | 1.91 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-phenylpropanoic acid;aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;aniline?
The IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;aniline (CID 159455369) is (2S)-2-amino-3-phenylpropanoic acid;aniline.
What is the SMILES notation for (2S)-2-amino-3-phenylpropanoic acid;aniline?
The canonical SMILES for (2S)-2-amino-3-phenylpropanoic acid;aniline is N[C@@H](Cc1ccccc1)C(=O)O.Nc1ccccc1.
What is the InChIKey of (2S)-2-amino-3-phenylpropanoic acid;aniline?
The InChIKey is LTXCOLDSOIFHGC-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H11NO2.C6H7N/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5,8H,6,10H2,(H,11,12);1-5H,7H2/t8-;/m0./s1.
What are the key properties of (2S)-2-amino-3-phenylpropanoic acid;aniline?
(2S)-2-amino-3-phenylpropanoic acid;aniline has a molecular weight of 258.32 g/mol, XLogP of 1.91, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-phenylpropanoic acid;aniline is sourced from PubChem (CID 159455369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).