C11H13NO3 — CID 150517437
(2R)-3-(3-acetylphenyl)-2-aminopropanoic acid (PubChem CID 150517437) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R)-3-(3-acetylphenyl)-2-aminopropanoic acid.
| Compound Name | (2R)-3-(3-acetylphenyl)-2-aminopropanoic acid |
|---|---|
| PubChem CID | 150517437 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2R)-3-(3-acetylphenyl)-2-aminopropanoic acid |
| SMILES | CC(=O)c1cccc(C[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C11H13NO3/c1-7(13)9-4-2-3-8(5-9)6-10(12)11(14)15/h2-5,10H,6,12H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | IBCKYXVMEMSMQM-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |