C10H13N3O3 — CID 173140434
(2R)-2-amino-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid (PubChem CID 173140434) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 173140434 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (2R)-2-amino-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid |
| SMILES | NC(=NO)c1cccc(C[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C10H13N3O3/c11-8(10(14)15)5-6-2-1-3-7(4-6)9(12)13-16/h1-4,8,16H,5,11H2,(H2,12,13)(H,14,15)/t8-/m1/s1 |
| InChIKey | QDTWPUMDDXFCHL-MRVPVSSYSA-N |
| XLogP | -0.26 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|