C9H10N2O3 — CID 90990640
2-[3-(N'-hydroxycarbamimidoyl)phenyl]acetic acid (PubChem CID 90990640) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenyl]acetic acid.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 90990640 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]acetic acid |
| SMILES | NC(=NO)c1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C9H10N2O3/c10-9(11-14)7-3-1-2-6(4-7)5-8(12)13/h1-4,14H,5H2,(H2,10,11)(H,12,13) |
| InChIKey | AGKGAIJRFDGTEA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|