C8H12N4O3S — CID 114959565
N'-hydroxy-3-[(sulfamoylamino)methyl]benzenecarboximidamide (PubChem CID 114959565) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is N'-hydroxy-3-[(sulfamoylamino)methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[(sulfamoylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 114959565 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N'-hydroxy-3-[(sulfamoylamino)methyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cccc(CNS(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H12N4O3S/c9-8(12-13)7-3-1-2-6(4-7)5-11-16(10,14)15/h1-4,11,13H,5H2,(H2,9,12)(H2,10,14,15) |
| InChIKey | UFAWUBUSLOOZKS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|