C11H16N4O5S — CID 114465943
ethyl N-[[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylsulfamoyl]carbamate (PubChem CID 114465943) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is ethyl N-[[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465943 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | ethyl N-[[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCc1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C11H16N4O5S/c1-2-20-11(16)15-21(18,19)13-7-8-4-3-5-9(6-8)10(12)14-17/h3-6,13,17H,2,7H2,1H3,(H2,12,14)(H,15,16) |
| InChIKey | AREHYRSIJYGACK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|