C14H22N4O2 — CID 77030886
2-[[3-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylpropanamide (PubChem CID 77030886) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[[3-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylpropanamide.
| Compound Name | 2-[[3-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 77030886 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[[3-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NCc1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-7-16-14(19)10(2)17-9-11-5-4-6-12(8-11)13(15)18-20/h4-6,8,10,17,20H,3,7,9H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | RUAXVPRTHFLNLH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|