C16H19N3O — CID 77028839
N'-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]benzenecarboximidamide (PubChem CID 77028839) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N'-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77028839 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N'-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]benzenecarboximidamide |
| SMILES | Cc1ccccc1CNCc1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C16H19N3O/c1-12-5-2-3-7-15(12)11-18-10-13-6-4-8-14(9-13)16(17)19-20/h2-9,18,20H,10-11H2,1H3,(H2,17,19) |
| InChIKey | VFUJBGIMAIOIMV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|