C13H15N3O2 — CID 77029542
3-[(furan-2-ylmethylamino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 77029542) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-[(furan-2-ylmethylamino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[(furan-2-ylmethylamino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77029542 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-[(furan-2-ylmethylamino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(CNCc2ccco2)c1 |
| InChI | InChI=1S/C13H15N3O2/c14-13(16-17)11-4-1-3-10(7-11)8-15-9-12-5-2-6-18-12/h1-7,15,17H,8-9H2,(H2,14,16) |
| InChIKey | FTLCKUFDOFFAKR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|