C11H17N3O3S — CID 55142319
3-[[ethylsulfonyl(methyl)amino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 55142319) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-[[ethylsulfonyl(methyl)amino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[ethylsulfonyl(methyl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 55142319 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-[[ethylsulfonyl(methyl)amino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCS(=O)(=O)N(C)Cc1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C11H17N3O3S/c1-3-18(16,17)14(2)8-9-5-4-6-10(7-9)11(12)13-15/h4-7,15H,3,8H2,1-2H3,(H2,12,13) |
| InChIKey | FOZAQSHHHHIBOB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|