C26H23NO2 — CID 54235669
benzyl (2S)-2-amino-3-(4-naphthalen-2-ylphenyl)propanoate (PubChem CID 54235669) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-(4-naphthalen-2-ylphenyl)propanoate.
| Compound Name | benzyl (2S)-2-amino-3-(4-naphthalen-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 54235669 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | benzyl (2S)-2-amino-3-(4-naphthalen-2-ylphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(-c2ccc3ccccc3c2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H23NO2/c27-25(26(28)29-18-20-6-2-1-3-7-20)16-19-10-12-22(13-11-19)24-15-14-21-8-4-5-9-23(21)17-24/h1-15,17,25H,16,18,27H2/t25-/m0/s1 |
| InChIKey | QMJVTKHRWGLWOO-VWLOTQADSA-N |
| XLogP | 5.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |