C21H22N2O8 — CID 22793921
(E)-but-2-enedioic acid;(4-nitrophenyl)methyl (2S)-2-amino-3-(2-methylphenyl)propanoate (PubChem CID 22793921) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(4-nitrophenyl)methyl (2S)-2-amino-3-(2-methylphenyl)propanoate.
| Compound Name | (E)-but-2-enedioic acid;(4-nitrophenyl)methyl (2S)-2-amino-3-(2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 22793921 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (E)-but-2-enedioic acid;(4-nitrophenyl)methyl (2S)-2-amino-3-(2-methylphenyl)propanoate |
| SMILES | Cc1ccccc1C[C@H](N)C(=O)OCc1ccc([N+](=O)[O-])cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H18N2O4.C4H4O4/c1-12-4-2-3-5-14(12)10-16(18)17(20)23-11-13-6-8-15(9-7-13)19(21)22;5-3(6)1-2-4(7)8/h2-9,16H,10-11,18H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m0./s1 |
| InChIKey | APEXEOKJIFUXJY-SBWPJONASA-N |
| XLogP | 2.23 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|