C28H30N2O7 — CID 95048951
(4-nitrophenyl)methyl (2R)-2-[tert-butyl(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 95048951) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-[tert-butyl(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | (4-nitrophenyl)methyl (2R)-2-[tert-butyl(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 95048951 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-[tert-butyl(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)N(C(=O)OCc1ccccc1)[C@H](Cc1ccc(O)cc1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H30N2O7/c1-28(2,3)29(27(33)37-19-21-7-5-4-6-8-21)25(17-20-11-15-24(31)16-12-20)26(32)36-18-22-9-13-23(14-10-22)30(34)35/h4-16,25,31H,17-19H2,1-3H3/t25-/m1/s1 |
| InChIKey | QQVHIIKQSAHFLH-RUZDIDTESA-N |
| XLogP | 5.39 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|