C41H38N2O8 — CID 99658366
benzyl (2S)-2-[[(2S)-2-[bis(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate (PubChem CID 99658366) has the molecular formula C41H38N2O8 and a molecular weight of 686.76 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[bis(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[bis(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 99658366 |
| Molecular Formula | C41H38N2O8 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[bis(phenylmethoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H38N2O8/c44-35-23-21-31(22-24-35)26-37(38(45)42-36(25-30-13-5-1-6-14-30)39(46)49-27-32-15-7-2-8-16-32)43(40(47)50-28-33-17-9-3-10-18-33)41(48)51-29-34-19-11-4-12-20-34/h1-24,36-37,44H,25-29H2,(H,42,45)/t36-,37-/m0/s1 |
| InChIKey | HIGPKGPPYVMXER-BCRBLDSWSA-N |
| XLogP | 6.75 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|