C35H31NO3 — CID 139081333
benzyl (2S)-3-(4-hydroxyphenyl)-2-(tritylamino)propanoate (PubChem CID 139081333) has the molecular formula C35H31NO3 and a molecular weight of 513.64 g/mol. Its IUPAC name is benzyl (2S)-3-(4-hydroxyphenyl)-2-(tritylamino)propanoate.
| Compound Name | benzyl (2S)-3-(4-hydroxyphenyl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 139081333 |
| Molecular Formula | C35H31NO3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | benzyl (2S)-3-(4-hydroxyphenyl)-2-(tritylamino)propanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cc1ccc(O)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31NO3/c37-32-23-21-27(22-24-32)25-33(34(38)39-26-28-13-5-1-6-14-28)36-35(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-24,33,36-37H,25-26H2/t33-/m0/s1 |
| InChIKey | LLBWREKYMHVTLL-XIFFEERXSA-N |
| XLogP | 6.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|